About ethane;(3Z,5E)-3-fluoro-6-methyl-4-(trifluoromethoxy)octa-3,5-diene
ethane;(3Z,5E)-3-fluoro-6-methyl-4-(trifluoromethoxy)octa-3,5-diene (PubChem CID 143344333) has the molecular formula C12H20F4O
and a molecular weight of 256.28 g/mol. Its IUPAC name is ethane;(3Z,5E)-3-fluoro-6-methyl-4-(trifluoromethoxy)octa-3,5-diene.
Molecular Properties
| Compound Name | ethane;(3Z,5E)-3-fluoro-6-methyl-4-(trifluoromethoxy)octa-3,5-diene |
| PubChem CID | 143344333 |
| Molecular Formula | C12H20F4O |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | ethane;(3Z,5E)-3-fluoro-6-methyl-4-(trifluoromethoxy)octa-3,5-diene |
| SMILES | CC.CC/C(F)=C(\C=C(/C)CC)OC(F)(F)F |
| InChI | InChI=1S/C10H14F4O.C2H6/c1-4-7(3)6-9(8(11)5-2)15-10(12,13)14;1-2/h6H,4-5H2,1-3H3;1-2H3/b7-6+,9-8-; |
| InChIKey | MTWMEGFSIHXHQB-CUOMSEFISA-N |
| XLogP | 5.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(3Z,5E)-3-fluoro-6-methyl-4-(trifluoromethoxy)octa-3,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(3Z,5E)-3-fluoro-6-methyl-4-(trifluoromethoxy)octa-3,5-diene?
The IUPAC name of ethane;(3Z,5E)-3-fluoro-6-methyl-4-(trifluoromethoxy)octa-3,5-diene (CID 143344333) is ethane;(3Z,5E)-3-fluoro-6-methyl-4-(trifluoromethoxy)octa-3,5-diene.
What is the SMILES notation for ethane;(3Z,5E)-3-fluoro-6-methyl-4-(trifluoromethoxy)octa-3,5-diene?
The canonical SMILES for ethane;(3Z,5E)-3-fluoro-6-methyl-4-(trifluoromethoxy)octa-3,5-diene is CC.CC/C(F)=C(\C=C(/C)CC)OC(F)(F)F.
What is the InChIKey of ethane;(3Z,5E)-3-fluoro-6-methyl-4-(trifluoromethoxy)octa-3,5-diene?
The InChIKey is MTWMEGFSIHXHQB-CUOMSEFISA-N. The full InChI is InChI=1S/C10H14F4O.C2H6/c1-4-7(3)6-9(8(11)5-2)15-10(12,13)14;1-2/h6H,4-5H2,1-3H3;1-2H3/b7-6+,9-8-;.
What are the key properties of ethane;(3Z,5E)-3-fluoro-6-methyl-4-(trifluoromethoxy)octa-3,5-diene?
ethane;(3Z,5E)-3-fluoro-6-methyl-4-(trifluoromethoxy)octa-3,5-diene has a molecular weight of 256.28 g/mol, XLogP of 5.50, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(3Z,5E)-3-fluoro-6-methyl-4-(trifluoromethoxy)octa-3,5-diene is sourced from PubChem (CID 143344333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).