C30H58 — CID 143344345
1-butan-2-yl-3,6-dimethylcyclooctane;2-methyl-4,6-di(propan-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene (PubChem CID 143344345) has the molecular formula C30H58 and a molecular weight of 418.79 g/mol. Its IUPAC name is 1-butan-2-yl-3,6-dimethylcyclooctane;2-methyl-4,6-di(propan-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene.
| Compound Name | 1-butan-2-yl-3,6-dimethylcyclooctane;2-methyl-4,6-di(propan-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
|---|---|
| PubChem CID | 143344345 |
| Molecular Formula | C30H58 |
| Molecular Weight | 418.79 g/mol |
| Exact Mass | 418.45 |
| IUPAC Name | 1-butan-2-yl-3,6-dimethylcyclooctane;2-methyl-4,6-di(propan-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
| SMILES | CC1CC2CC(C(C)C)CC(C(C)C)C2C1.CCC(C)C1CCC(C)CCC(C)C1 |
| InChI | InChI=1S/C16H30.C14H28/c1-10(2)13-8-14-6-12(5)7-16(14)15(9-13)11(3)4;1-5-13(4)14-9-8-11(2)6-7-12(3)10-14/h10-16H,6-9H2,1-5H3;11-14H,5-10H2,1-4H3 |
| InChIKey | VOMAHRXLSHKGGK-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.79 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |