C23H28N6 — CID 143344383
3-N-ethynyl-1-methyl-2-[N-methyl-C-[1-[(2-methylidene-3,4-dihydro-1H-quinolin-7-yl)methylamino]ethenyl]carbonimidoyl]-4H-pyridine-3,5-diamine (PubChem CID 143344383) has the molecular formula C23H28N6 and a molecular weight of 388.52 g/mol. Its IUPAC name is 3-N-ethynyl-1-methyl-2-[N-methyl-C-[1-[(2-methylidene-3,4-dihydro-1H-quinolin-7-yl)methylamino]ethenyl]carbonimidoyl]-4H-pyridine-3,5-diamine.
| Compound Name | 3-N-ethynyl-1-methyl-2-[N-methyl-C-[1-[(2-methylidene-3,4-dihydro-1H-quinolin-7-yl)methylamino]ethenyl]carbonimidoyl]-4H-pyridine-3,5-diamine |
|---|---|
| PubChem CID | 143344383 |
| Molecular Formula | C23H28N6 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 3-N-ethynyl-1-methyl-2-[N-methyl-C-[1-[(2-methylidene-3,4-dihydro-1H-quinolin-7-yl)methylamino]ethenyl]carbonimidoyl]-4H-pyridine-3,5-diamine |
| SMILES | C#CNC1=C(/C(=N/C)C(=C)NCc2ccc3c(c2)NC(=C)CC3)N(C)C=C(N)C1 |
| InChI | InChI=1S/C23H28N6/c1-6-26-21-12-19(24)14-29(5)23(21)22(25-4)16(3)27-13-17-8-10-18-9-7-15(2)28-20(18)11-17/h1,8,10-11,14,26-28H,2-3,7,9,12-13,24H2,4-5H3/b25-22+ |
| InChIKey | RRXZRYMORUWGKK-YYDJUVGSSA-N |
| XLogP | 2.76 |
| TPSA | 77.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|