C29H39F2N3 — CID 143344415
(4E)-2-N-[[7-(1,1-difluoroethyl)-1-azacyclohepta-2,4,5,7-tetraen-4-yl]methyl]-4-ethyl-6-methyl-3-methylidene-7-N-[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl]octa-1,4,7-triene-2,7-diamine (PubChem CID 143344415) has the molecular formula C29H39F2N3 and a molecular weight of 467.65 g/mol. Its IUPAC name is (4E)-2-N-[[7-(1,1-difluoroethyl)-1-azacyclohepta-2,4,5,7-tetraen-4-yl]methyl]-4-ethyl-6-methyl-3-methylidene-7-N-[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl]octa-1,4,7-triene-2,7-diamine.
| Compound Name | (4E)-2-N-[[7-(1,1-difluoroethyl)-1-azacyclohepta-2,4,5,7-tetraen-4-yl]methyl]-4-ethyl-6-methyl-3-methylidene-7-N-[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl]octa-1,4,7-triene-2,7-diamine |
|---|---|
| PubChem CID | 143344415 |
| Molecular Formula | C29H39F2N3 |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 467.31 |
| IUPAC Name | (4E)-2-N-[[7-(1,1-difluoroethyl)-1-azacyclohepta-2,4,5,7-tetraen-4-yl]methyl]-4-ethyl-6-methyl-3-methylidene-7-N-[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl]octa-1,4,7-triene-2,7-diamine |
| SMILES | C=C(NCC1=C=CC(C(C)(F)F)=NC=C1)C(=C)/C(=C/C(C)C(=C)NCC(/C=C\C)=C/CC)CC |
| InChI | InChI=1S/C29H39F2N3/c1-9-12-25(13-10-2)19-33-23(6)21(4)18-27(11-3)22(5)24(7)34-20-26-14-15-28(29(8,30)31)32-17-16-26/h9,12-13,15-18,21,33-34H,5-7,10-11,19-20H2,1-4,8H3/b12-9-,25-13+,27-18+ |
| InChIKey | BTIMYXBHQCGRMJ-BCSYGBOJSA-N |
| XLogP | 7.34 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|