About ethane;5-ethenyl-3-methyl-1,3-oxazol-2-one;(E)-3-methylpent-2-ene
ethane;5-ethenyl-3-methyl-1,3-oxazol-2-one;(E)-3-methylpent-2-ene (PubChem CID 143344464) has the molecular formula C14H25NO2
and a molecular weight of 239.36 g/mol. Its IUPAC name is ethane;5-ethenyl-3-methyl-1,3-oxazol-2-one;(E)-3-methylpent-2-ene.
Molecular Properties
| Compound Name | ethane;5-ethenyl-3-methyl-1,3-oxazol-2-one;(E)-3-methylpent-2-ene |
| PubChem CID | 143344464 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | ethane;5-ethenyl-3-methyl-1,3-oxazol-2-one;(E)-3-methylpent-2-ene |
| SMILES | C/C=C(\C)CC.C=Cc1cn(C)c(=O)o1.CC |
| InChI | InChI=1S/C6H7NO2.C6H12.C2H6/c1-3-5-4-7(2)6(8)9-5;1-4-6(3)5-2;1-2/h3-4H,1H2,2H3;4H,5H2,1-3H3;1-2H3/b;6-4+; |
| InChIKey | CBXQHCMOYFFWDR-HWWUXOKASA-N |
| XLogP | 4.01 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;5-ethenyl-3-methyl-1,3-oxazol-2-one;(E)-3-methylpent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-ethenyl-3-methyl-1,3-oxazol-2-one;(E)-3-methylpent-2-ene?
The IUPAC name of ethane;5-ethenyl-3-methyl-1,3-oxazol-2-one;(E)-3-methylpent-2-ene (CID 143344464) is ethane;5-ethenyl-3-methyl-1,3-oxazol-2-one;(E)-3-methylpent-2-ene.
What is the SMILES notation for ethane;5-ethenyl-3-methyl-1,3-oxazol-2-one;(E)-3-methylpent-2-ene?
The canonical SMILES for ethane;5-ethenyl-3-methyl-1,3-oxazol-2-one;(E)-3-methylpent-2-ene is C/C=C(\C)CC.C=Cc1cn(C)c(=O)o1.CC.
What is the InChIKey of ethane;5-ethenyl-3-methyl-1,3-oxazol-2-one;(E)-3-methylpent-2-ene?
The InChIKey is CBXQHCMOYFFWDR-HWWUXOKASA-N. The full InChI is InChI=1S/C6H7NO2.C6H12.C2H6/c1-3-5-4-7(2)6(8)9-5;1-4-6(3)5-2;1-2/h3-4H,1H2,2H3;4H,5H2,1-3H3;1-2H3/b;6-4+;.
What are the key properties of ethane;5-ethenyl-3-methyl-1,3-oxazol-2-one;(E)-3-methylpent-2-ene?
ethane;5-ethenyl-3-methyl-1,3-oxazol-2-one;(E)-3-methylpent-2-ene has a molecular weight of 239.36 g/mol, XLogP of 4.01, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-ethenyl-3-methyl-1,3-oxazol-2-one;(E)-3-methylpent-2-ene is sourced from PubChem (CID 143344464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).