C28H42N2 — CID 143344581
(Z,2S,3E)-N-[(5E)-3-but-1-en-2-ylimino-6,8-dimethylnona-1,5,8-trien-2-yl]-3-ethylidene-6,7-dimethylidenenon-4-en-2-amine (PubChem CID 143344581) has the molecular formula C28H42N2 and a molecular weight of 406.66 g/mol. Its IUPAC name is (Z,2S,3E)-N-[(5E)-3-but-1-en-2-ylimino-6,8-dimethylnona-1,5,8-trien-2-yl]-3-ethylidene-6,7-dimethylidenenon-4-en-2-amine.
| Compound Name | (Z,2S,3E)-N-[(5E)-3-but-1-en-2-ylimino-6,8-dimethylnona-1,5,8-trien-2-yl]-3-ethylidene-6,7-dimethylidenenon-4-en-2-amine |
|---|---|
| PubChem CID | 143344581 |
| Molecular Formula | C28H42N2 |
| Molecular Weight | 406.66 g/mol |
| Exact Mass | 406.33 |
| IUPAC Name | (Z,2S,3E)-N-[(5E)-3-but-1-en-2-ylimino-6,8-dimethylnona-1,5,8-trien-2-yl]-3-ethylidene-6,7-dimethylidenenon-4-en-2-amine |
| SMILES | C=C(C)C/C(C)=C/C/C(=N\C(=C)CC)C(=C)N[C@@H](C)C(/C=C\C(=C)C(=C)CC)=C/C |
| InChI | InChI=1S/C28H42N2/c1-12-22(7)23(8)16-17-27(14-3)25(10)30-26(11)28(29-24(9)13-2)18-15-21(6)19-20(4)5/h14-17,25,30H,4,7-9,11-13,18-19H2,1-3,5-6,10H3/b17-16-,21-15+,27-14+,29-28+/t25-/m0/s1 |
| InChIKey | IGCKWQXIBRDDMI-OYGMOESQSA-N |
| XLogP | 8.17 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.66 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|