C24H35FN4 — CID 143344773
N'-ethyl-N-[(4E)-2-[(4-fluoro-3-methylcyclohepta-1,3,5-trien-1-yl)methylamino]-5,6-dimethylhepta-1,4,6-trien-3-ylidene]ethanimidamide;N-methylmethanimine (PubChem CID 143344773) has the molecular formula C24H35FN4 and a molecular weight of 398.57 g/mol. Its IUPAC name is N'-ethyl-N-[(4E)-2-[(4-fluoro-3-methylcyclohepta-1,3,5-trien-1-yl)methylamino]-5,6-dimethylhepta-1,4,6-trien-3-ylidene]ethanimidamide;N-methylmethanimine.
| Compound Name | N'-ethyl-N-[(4E)-2-[(4-fluoro-3-methylcyclohepta-1,3,5-trien-1-yl)methylamino]-5,6-dimethylhepta-1,4,6-trien-3-ylidene]ethanimidamide;N-methylmethanimine |
|---|---|
| PubChem CID | 143344773 |
| Molecular Formula | C24H35FN4 |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | N'-ethyl-N-[(4E)-2-[(4-fluoro-3-methylcyclohepta-1,3,5-trien-1-yl)methylamino]-5,6-dimethylhepta-1,4,6-trien-3-ylidene]ethanimidamide;N-methylmethanimine |
| SMILES | C=C(C)/C(C)=C/C(=N\C(C)=N\CC)C(=C)NCC1=CC(C)=C(F)C=CC1.C=NC |
| InChI | InChI=1S/C22H30FN3.C2H5N/c1-8-24-19(7)26-22(13-16(4)15(2)3)18(6)25-14-20-10-9-11-21(23)17(5)12-20;1-3-2/h9,11-13,25H,2,6,8,10,14H2,1,3-5,7H3;1H2,2H3/b16-13+,24-19+,26-22+; |
| InChIKey | HCOMJDQFQQDBLT-OLAWIUNZSA-N |
| XLogP | 5.94 |
| TPSA | 49.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|