C20H21FN6O2 — CID 143344929
7-N-[(3Z,6E)-6-cyanocyclodeca-3,6-dien-1-yl]-3-fluoro-5-N-methylpyrazolo[1,5-a]pyrimidine-5,7-dicarboxamide (PubChem CID 143344929) has the molecular formula C20H21FN6O2 and a molecular weight of 396.43 g/mol. Its IUPAC name is 7-N-[(3Z,6E)-6-cyanocyclodeca-3,6-dien-1-yl]-3-fluoro-5-N-methylpyrazolo[1,5-a]pyrimidine-5,7-dicarboxamide.
| Compound Name | 7-N-[(3Z,6E)-6-cyanocyclodeca-3,6-dien-1-yl]-3-fluoro-5-N-methylpyrazolo[1,5-a]pyrimidine-5,7-dicarboxamide |
|---|---|
| PubChem CID | 143344929 |
| Molecular Formula | C20H21FN6O2 |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 7-N-[(3Z,6E)-6-cyanocyclodeca-3,6-dien-1-yl]-3-fluoro-5-N-methylpyrazolo[1,5-a]pyrimidine-5,7-dicarboxamide |
| SMILES | CNC(=O)c1cc(C(=O)NC2C/C=C\C/C(C#N)=C\CCC2)n2ncc(F)c2n1 |
| InChI | InChI=1S/C20H21FN6O2/c1-23-19(28)16-10-17(27-18(26-16)15(21)12-24-27)20(29)25-14-8-4-2-6-13(11-22)7-3-5-9-14/h2,4,7,10,12,14H,3,5-6,8-9H2,1H3,(H,23,28)(H,25,29)/b4-2-,13-7+ |
| InChIKey | DRMUDVUSLFKJEN-QIWMAIDYSA-N |
| XLogP | 2.30 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|