C9H12N2O — CID 143344953
3-[(4Z)-hexa-2,4-dienyl]-4-methyl-1,2,5-oxadiazole (PubChem CID 143344953) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 3-[(4Z)-hexa-2,4-dienyl]-4-methyl-1,2,5-oxadiazole.
| Compound Name | 3-[(4Z)-hexa-2,4-dienyl]-4-methyl-1,2,5-oxadiazole |
|---|---|
| PubChem CID | 143344953 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 3-[(4Z)-hexa-2,4-dienyl]-4-methyl-1,2,5-oxadiazole |
| SMILES | C/C=C\C=CCc1nonc1C |
| InChI | InChI=1S/C9H12N2O/c1-3-4-5-6-7-9-8(2)10-12-11-9/h3-6H,7H2,1-2H3/b4-3-,6-5? |
| InChIKey | VWNHRNBGTXRXTI-KWRQCDRVSA-N |
| XLogP | 2.05 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|