About ethane;6-ethyl-N-methylcyclohepta-1,3,6-trien-1-amine;formamide
ethane;6-ethyl-N-methylcyclohepta-1,3,6-trien-1-amine;formamide (PubChem CID 143345093) has the molecular formula C13H24N2O
and a molecular weight of 224.35 g/mol. Its IUPAC name is ethane;6-ethyl-N-methylcyclohepta-1,3,6-trien-1-amine;formamide.
Molecular Properties
| Compound Name | ethane;6-ethyl-N-methylcyclohepta-1,3,6-trien-1-amine;formamide |
| PubChem CID | 143345093 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | ethane;6-ethyl-N-methylcyclohepta-1,3,6-trien-1-amine;formamide |
| SMILES | CC.CCC1=CC(NC)=CC=CC1.NC=O |
| InChI | InChI=1S/C10H15N.C2H6.CH3NO/c1-3-9-6-4-5-7-10(8-9)11-2;1-2;2-1-3/h4-5,7-8,11H,3,6H2,1-2H3;1-2H3;1H,(H2,2,3) |
| InChIKey | DEHIUROPTYAULR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;6-ethyl-N-methylcyclohepta-1,3,6-trien-1-amine;formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-ethyl-N-methylcyclohepta-1,3,6-trien-1-amine;formamide?
The IUPAC name of ethane;6-ethyl-N-methylcyclohepta-1,3,6-trien-1-amine;formamide (CID 143345093) is ethane;6-ethyl-N-methylcyclohepta-1,3,6-trien-1-amine;formamide.
What is the SMILES notation for ethane;6-ethyl-N-methylcyclohepta-1,3,6-trien-1-amine;formamide?
The canonical SMILES for ethane;6-ethyl-N-methylcyclohepta-1,3,6-trien-1-amine;formamide is CC.CCC1=CC(NC)=CC=CC1.NC=O.
What is the InChIKey of ethane;6-ethyl-N-methylcyclohepta-1,3,6-trien-1-amine;formamide?
The InChIKey is DEHIUROPTYAULR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N.C2H6.CH3NO/c1-3-9-6-4-5-7-10(8-9)11-2;1-2;2-1-3/h4-5,7-8,11H,3,6H2,1-2H3;1-2H3;1H,(H2,2,3).
What are the key properties of ethane;6-ethyl-N-methylcyclohepta-1,3,6-trien-1-amine;formamide?
ethane;6-ethyl-N-methylcyclohepta-1,3,6-trien-1-amine;formamide has a molecular weight of 224.35 g/mol, XLogP of 2.51, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-ethyl-N-methylcyclohepta-1,3,6-trien-1-amine;formamide is sourced from PubChem (CID 143345093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).