C20H31FN4 — CID 143345270
N-[2-[[(3Z,5E)-5-fluoro-2,6-dimethylocta-3,5,7-trienyl]amino]pent-1-en-3-ylidene]-N'-[2-(methylamino)prop-2-enyl]methanimidamide (PubChem CID 143345270) has the molecular formula C20H31FN4 and a molecular weight of 346.49 g/mol. Its IUPAC name is N-[2-[[(3Z,5E)-5-fluoro-2,6-dimethylocta-3,5,7-trienyl]amino]pent-1-en-3-ylidene]-N'-[2-(methylamino)prop-2-enyl]methanimidamide.
| Compound Name | N-[2-[[(3Z,5E)-5-fluoro-2,6-dimethylocta-3,5,7-trienyl]amino]pent-1-en-3-ylidene]-N'-[2-(methylamino)prop-2-enyl]methanimidamide |
|---|---|
| PubChem CID | 143345270 |
| Molecular Formula | C20H31FN4 |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | N-[2-[[(3Z,5E)-5-fluoro-2,6-dimethylocta-3,5,7-trienyl]amino]pent-1-en-3-ylidene]-N'-[2-(methylamino)prop-2-enyl]methanimidamide |
| SMILES | C=C/C(C)=C(F)\C=C/C(C)CNC(=C)/C(CC)=N/C=N/CC(=C)NC |
| InChI | InChI=1S/C20H31FN4/c1-8-16(4)19(21)11-10-15(3)12-24-18(6)20(9-2)25-14-23-13-17(5)22-7/h8,10-11,14-15,22,24H,1,5-6,9,12-13H2,2-4,7H3/b11-10-,19-16+,23-14+,25-20+ |
| InChIKey | UJYIWOYCVRMSSD-ORSKKUFWSA-N |
| XLogP | 4.32 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|