About 5-ethenyl-2-methyl-4-[(E)-2-methylpent-1-enyl]-3H-1,2-thiazole
5-ethenyl-2-methyl-4-[(E)-2-methylpent-1-enyl]-3H-1,2-thiazole (PubChem CID 143345882) has the molecular formula C12H19NS
and a molecular weight of 209.36 g/mol. Its IUPAC name is 5-ethenyl-2-methyl-4-[(E)-2-methylpent-1-enyl]-3H-1,2-thiazole.
Molecular Properties
| Compound Name | 5-ethenyl-2-methyl-4-[(E)-2-methylpent-1-enyl]-3H-1,2-thiazole |
| PubChem CID | 143345882 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 5-ethenyl-2-methyl-4-[(E)-2-methylpent-1-enyl]-3H-1,2-thiazole |
| SMILES | C=CC1=C(/C=C(\C)CCC)CN(C)S1 |
| InChI | InChI=1S/C12H19NS/c1-5-7-10(3)8-11-9-13(4)14-12(11)6-2/h6,8H,2,5,7,9H2,1,3-4H3/b10-8+ |
| InChIKey | UNKGHPQPPWHGNF-CSKARUKUSA-N |
| XLogP | 3.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-ethenyl-2-methyl-4-[(E)-2-methylpent-1-enyl]-3H-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-2-methyl-4-[(E)-2-methylpent-1-enyl]-3H-1,2-thiazole?
The IUPAC name of 5-ethenyl-2-methyl-4-[(E)-2-methylpent-1-enyl]-3H-1,2-thiazole (CID 143345882) is 5-ethenyl-2-methyl-4-[(E)-2-methylpent-1-enyl]-3H-1,2-thiazole.
What is the SMILES notation for 5-ethenyl-2-methyl-4-[(E)-2-methylpent-1-enyl]-3H-1,2-thiazole?
The canonical SMILES for 5-ethenyl-2-methyl-4-[(E)-2-methylpent-1-enyl]-3H-1,2-thiazole is C=CC1=C(/C=C(\C)CCC)CN(C)S1.
What is the InChIKey of 5-ethenyl-2-methyl-4-[(E)-2-methylpent-1-enyl]-3H-1,2-thiazole?
The InChIKey is UNKGHPQPPWHGNF-CSKARUKUSA-N. The full InChI is InChI=1S/C12H19NS/c1-5-7-10(3)8-11-9-13(4)14-12(11)6-2/h6,8H,2,5,7,9H2,1,3-4H3/b10-8+.
What are the key properties of 5-ethenyl-2-methyl-4-[(E)-2-methylpent-1-enyl]-3H-1,2-thiazole?
5-ethenyl-2-methyl-4-[(E)-2-methylpent-1-enyl]-3H-1,2-thiazole has a molecular weight of 209.36 g/mol, XLogP of 3.77, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-2-methyl-4-[(E)-2-methylpent-1-enyl]-3H-1,2-thiazole is sourced from PubChem (CID 143345882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).