C9H11BrO — CID 143346047
5-bromo-2,3,7,7a-tetrahydro-1H-inden-1-ol (PubChem CID 143346047) has the molecular formula C9H11BrO and a molecular weight of 215.09 g/mol. Its IUPAC name is 5-bromo-2,3,7,7a-tetrahydro-1H-inden-1-ol.
| Compound Name | 5-bromo-2,3,7,7a-tetrahydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 143346047 |
| Molecular Formula | C9H11BrO |
| Molecular Weight | 215.09 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | 5-bromo-2,3,7,7a-tetrahydro-1H-inden-1-ol |
| SMILES | OC1CCC2=CC(Br)=CCC21 |
| InChI | InChI=1S/C9H11BrO/c10-7-2-3-8-6(5-7)1-4-9(8)11/h2,5,8-9,11H,1,3-4H2 |
| InChIKey | HFWHJXOBRSTXRY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.09 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |