C16H31NO — CID 143346048
N,N-dimethylacetamide;ethane;(3Z,5Z)-5-ethylocta-1,3,5-triene (PubChem CID 143346048) has the molecular formula C16H31NO and a molecular weight of 253.43 g/mol. Its IUPAC name is N,N-dimethylacetamide;ethane;(3Z,5Z)-5-ethylocta-1,3,5-triene.
| Compound Name | N,N-dimethylacetamide;ethane;(3Z,5Z)-5-ethylocta-1,3,5-triene |
|---|---|
| PubChem CID | 143346048 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | N,N-dimethylacetamide;ethane;(3Z,5Z)-5-ethylocta-1,3,5-triene |
| SMILES | C=C/C=C\C(=C/CC)CC.CC.CC(=O)N(C)C |
| InChI | InChI=1S/C10H16.C4H9NO.C2H6/c1-4-7-9-10(6-3)8-5-2;1-4(6)5(2)3;1-2/h4,7-9H,1,5-6H2,2-3H3;1-3H3;1-2H3/b9-7-,10-8-;; |
| InChIKey | NZCQVWIATYKURV-RXRQIEPESA-N |
| XLogP | 4.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|