C19H30N2O2 — CID 143346182
3-amino-4-[[(4Z)-5-ethyl-2-methylhepta-2,4,6-trien-3-yl]-propylamino]cyclobut-3-ene-1,2-dione;ethane (PubChem CID 143346182) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is 3-amino-4-[[(4Z)-5-ethyl-2-methylhepta-2,4,6-trien-3-yl]-propylamino]cyclobut-3-ene-1,2-dione;ethane.
| Compound Name | 3-amino-4-[[(4Z)-5-ethyl-2-methylhepta-2,4,6-trien-3-yl]-propylamino]cyclobut-3-ene-1,2-dione;ethane |
|---|---|
| PubChem CID | 143346182 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | 3-amino-4-[[(4Z)-5-ethyl-2-methylhepta-2,4,6-trien-3-yl]-propylamino]cyclobut-3-ene-1,2-dione;ethane |
| SMILES | C=C/C(=C\C(=C(C)C)N(CCC)c1c(N)c(=O)c1=O)CC.CC |
| InChI | InChI=1S/C17H24N2O2.C2H6/c1-6-9-19(15-14(18)16(20)17(15)21)13(11(4)5)10-12(7-2)8-3;1-2/h7,10H,2,6,8-9,18H2,1,3-5H3;1-2H3/b12-10+; |
| InChIKey | MJFHUBMKRHHQFD-VHPXAQPISA-N |
| XLogP | 3.92 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|