C14H22N2 — CID 143346283
(2E)-6-but-1-en-2-yl-4-ethenyl-2-ethylidene-6-methyl-5,7-dihydro-1H-1,3-diazepine (PubChem CID 143346283) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is (2E)-6-but-1-en-2-yl-4-ethenyl-2-ethylidene-6-methyl-5,7-dihydro-1H-1,3-diazepine.
| Compound Name | (2E)-6-but-1-en-2-yl-4-ethenyl-2-ethylidene-6-methyl-5,7-dihydro-1H-1,3-diazepine |
|---|---|
| PubChem CID | 143346283 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | (2E)-6-but-1-en-2-yl-4-ethenyl-2-ethylidene-6-methyl-5,7-dihydro-1H-1,3-diazepine |
| SMILES | C=CC1=N/C(=C/C)NCC(C)(C(=C)CC)C1 |
| InChI | InChI=1S/C14H22N2/c1-6-11(4)14(5)9-12(7-2)16-13(8-3)15-10-14/h7-8,15H,2,4,6,9-10H2,1,3,5H3/b13-8+ |
| InChIKey | PAPDNNHVWLTJEM-MDWZMJQESA-N |
| XLogP | 3.44 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|