About ethane;2-methylbutan-2-yl 4-(aminomethyl)-2-methylbenzoate;molecular hydrogen
ethane;2-methylbutan-2-yl 4-(aminomethyl)-2-methylbenzoate;molecular hydrogen (PubChem CID 143346324) has the molecular formula C16H29NO2
and a molecular weight of 267.41 g/mol. Its IUPAC name is ethane;2-methylbutan-2-yl 4-(aminomethyl)-2-methylbenzoate;molecular hydrogen.
Molecular Properties
| Compound Name | ethane;2-methylbutan-2-yl 4-(aminomethyl)-2-methylbenzoate;molecular hydrogen |
| PubChem CID | 143346324 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | ethane;2-methylbutan-2-yl 4-(aminomethyl)-2-methylbenzoate;molecular hydrogen |
| SMILES | CC.CCC(C)(C)OC(=O)c1ccc(CN)cc1C.[H][H] |
| InChI | InChI=1S/C14H21NO2.C2H6.H2/c1-5-14(3,4)17-13(16)12-7-6-11(9-15)8-10(12)2;1-2;/h6-8H,5,9,15H2,1-4H3;1-2H3;1H |
| InChIKey | ZAAMZQQZEKBHQB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-methylbutan-2-yl 4-(aminomethyl)-2-methylbenzoate;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylbutan-2-yl 4-(aminomethyl)-2-methylbenzoate;molecular hydrogen?
The IUPAC name of ethane;2-methylbutan-2-yl 4-(aminomethyl)-2-methylbenzoate;molecular hydrogen (CID 143346324) is ethane;2-methylbutan-2-yl 4-(aminomethyl)-2-methylbenzoate;molecular hydrogen.
What is the SMILES notation for ethane;2-methylbutan-2-yl 4-(aminomethyl)-2-methylbenzoate;molecular hydrogen?
The canonical SMILES for ethane;2-methylbutan-2-yl 4-(aminomethyl)-2-methylbenzoate;molecular hydrogen is CC.CCC(C)(C)OC(=O)c1ccc(CN)cc1C.[H][H].
What is the InChIKey of ethane;2-methylbutan-2-yl 4-(aminomethyl)-2-methylbenzoate;molecular hydrogen?
The InChIKey is ZAAMZQQZEKBHQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO2.C2H6.H2/c1-5-14(3,4)17-13(16)12-7-6-11(9-15)8-10(12)2;1-2;/h6-8H,5,9,15H2,1-4H3;1-2H3;1H.
What are the key properties of ethane;2-methylbutan-2-yl 4-(aminomethyl)-2-methylbenzoate;molecular hydrogen?
ethane;2-methylbutan-2-yl 4-(aminomethyl)-2-methylbenzoate;molecular hydrogen has a molecular weight of 267.41 g/mol, XLogP of 4.07, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylbutan-2-yl 4-(aminomethyl)-2-methylbenzoate;molecular hydrogen is sourced from PubChem (CID 143346324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).