C15H15FN6OP2 — CID 143346349
N-[[2-[fluoro-bis(phosphanyl)methyl]-4-pyridinyl]methyl]-7-(methylideneamino)-5H-pyrrolo[3,2-d]pyrimidine-4-carboxamide (PubChem CID 143346349) has the molecular formula C15H15FN6OP2 and a molecular weight of 376.27 g/mol. Its IUPAC name is N-[[2-[fluoro-bis(phosphanyl)methyl]-4-pyridinyl]methyl]-7-(methylideneamino)-5H-pyrrolo[3,2-d]pyrimidine-4-carboxamide.
| Compound Name | N-[[2-[fluoro-bis(phosphanyl)methyl]-4-pyridinyl]methyl]-7-(methylideneamino)-5H-pyrrolo[3,2-d]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 143346349 |
| Molecular Formula | C15H15FN6OP2 |
| Molecular Weight | 376.27 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | N-[[2-[fluoro-bis(phosphanyl)methyl]-4-pyridinyl]methyl]-7-(methylideneamino)-5H-pyrrolo[3,2-d]pyrimidine-4-carboxamide |
| SMILES | C=Nc1c[nH]c2c(C(=O)NCc3ccnc(C(F)(P)P)c3)ncnc12 |
| InChI | InChI=1S/C15H15FN6OP2/c1-17-9-6-19-12-11(9)21-7-22-13(12)14(23)20-5-8-2-3-18-10(4-8)15(16,24)25/h2-4,6-7,19H,1,5,24-25H2,(H,20,23) |
| InChIKey | VGZOODBWVBADAU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.27 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|