About ethane;[4-ethyl-3-(ethylideneamino)cyclohepta-1,3,6-trien-1-yl]methanamine
ethane;[4-ethyl-3-(ethylideneamino)cyclohepta-1,3,6-trien-1-yl]methanamine (PubChem CID 143346533) has the molecular formula C14H24N2
and a molecular weight of 220.36 g/mol. Its IUPAC name is ethane;[4-ethyl-3-(ethylideneamino)cyclohepta-1,3,6-trien-1-yl]methanamine.
Molecular Properties
| Compound Name | ethane;[4-ethyl-3-(ethylideneamino)cyclohepta-1,3,6-trien-1-yl]methanamine |
| PubChem CID | 143346533 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | ethane;[4-ethyl-3-(ethylideneamino)cyclohepta-1,3,6-trien-1-yl]methanamine |
| SMILES | C/C=N/C1=C(CC)CC=CC(CN)=C1.CC |
| InChI | InChI=1S/C12H18N2.C2H6/c1-3-11-7-5-6-10(9-13)8-12(11)14-4-2;1-2/h4-6,8H,3,7,9,13H2,1-2H3;1-2H3/b14-4+; |
| InChIKey | KXIOIURZEPVWMR-BIZGWHPPSA-N |
| XLogP | 3.61 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;[4-ethyl-3-(ethylideneamino)cyclohepta-1,3,6-trien-1-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[4-ethyl-3-(ethylideneamino)cyclohepta-1,3,6-trien-1-yl]methanamine?
The IUPAC name of ethane;[4-ethyl-3-(ethylideneamino)cyclohepta-1,3,6-trien-1-yl]methanamine (CID 143346533) is ethane;[4-ethyl-3-(ethylideneamino)cyclohepta-1,3,6-trien-1-yl]methanamine.
What is the SMILES notation for ethane;[4-ethyl-3-(ethylideneamino)cyclohepta-1,3,6-trien-1-yl]methanamine?
The canonical SMILES for ethane;[4-ethyl-3-(ethylideneamino)cyclohepta-1,3,6-trien-1-yl]methanamine is C/C=N/C1=C(CC)CC=CC(CN)=C1.CC.
What is the InChIKey of ethane;[4-ethyl-3-(ethylideneamino)cyclohepta-1,3,6-trien-1-yl]methanamine?
The InChIKey is KXIOIURZEPVWMR-BIZGWHPPSA-N. The full InChI is InChI=1S/C12H18N2.C2H6/c1-3-11-7-5-6-10(9-13)8-12(11)14-4-2;1-2/h4-6,8H,3,7,9,13H2,1-2H3;1-2H3/b14-4+;.
What are the key properties of ethane;[4-ethyl-3-(ethylideneamino)cyclohepta-1,3,6-trien-1-yl]methanamine?
ethane;[4-ethyl-3-(ethylideneamino)cyclohepta-1,3,6-trien-1-yl]methanamine has a molecular weight of 220.36 g/mol, XLogP of 3.61, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[4-ethyl-3-(ethylideneamino)cyclohepta-1,3,6-trien-1-yl]methanamine is sourced from PubChem (CID 143346533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).