C16H30N2O — CID 143346562
ethane;methanamine;5-methyl-4-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-3,6-dihydro-2H-pyridine-1-carbaldehyde (PubChem CID 143346562) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is ethane;methanamine;5-methyl-4-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-3,6-dihydro-2H-pyridine-1-carbaldehyde.
| Compound Name | ethane;methanamine;5-methyl-4-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-3,6-dihydro-2H-pyridine-1-carbaldehyde |
|---|---|
| PubChem CID | 143346562 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | ethane;methanamine;5-methyl-4-[(1Z,3Z)-3-methylpenta-1,3-dienyl]-3,6-dihydro-2H-pyridine-1-carbaldehyde |
| SMILES | C/C=C(C)\C=C/C1=C(C)CN(C=O)CC1.CC.CN |
| InChI | InChI=1S/C13H19NO.C2H6.CH5N/c1-4-11(2)5-6-13-7-8-14(10-15)9-12(13)3;2*1-2/h4-6,10H,7-9H2,1-3H3;1-2H3;2H2,1H3/b6-5-,11-4-;; |
| InChIKey | KZWDXCKJRPJQHI-NNOGCUPJSA-N |
| XLogP | 3.29 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|