About 2,5-dimethyl-4-[(Z)-3-methylidenepent-1-enyl]-1,3-oxazole
2,5-dimethyl-4-[(Z)-3-methylidenepent-1-enyl]-1,3-oxazole (PubChem CID 143346683) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is 2,5-dimethyl-4-[(Z)-3-methylidenepent-1-enyl]-1,3-oxazole.
Molecular Properties
| Compound Name | 2,5-dimethyl-4-[(Z)-3-methylidenepent-1-enyl]-1,3-oxazole |
| PubChem CID | 143346683 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 2,5-dimethyl-4-[(Z)-3-methylidenepent-1-enyl]-1,3-oxazole |
| SMILES | C=C(/C=C\c1nc(C)oc1C)CC |
| InChI | InChI=1S/C11H15NO/c1-5-8(2)6-7-11-9(3)13-10(4)12-11/h6-7H,2,5H2,1,3-4H3/b7-6- |
| InChIKey | HOWBZCFEYSIFEH-SREVYHEPSA-N |
| XLogP | 3.27 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethyl-4-[(Z)-3-methylidenepent-1-enyl]-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-4-[(Z)-3-methylidenepent-1-enyl]-1,3-oxazole?
The IUPAC name of 2,5-dimethyl-4-[(Z)-3-methylidenepent-1-enyl]-1,3-oxazole (CID 143346683) is 2,5-dimethyl-4-[(Z)-3-methylidenepent-1-enyl]-1,3-oxazole.
What is the SMILES notation for 2,5-dimethyl-4-[(Z)-3-methylidenepent-1-enyl]-1,3-oxazole?
The canonical SMILES for 2,5-dimethyl-4-[(Z)-3-methylidenepent-1-enyl]-1,3-oxazole is C=C(/C=C\c1nc(C)oc1C)CC.
What is the InChIKey of 2,5-dimethyl-4-[(Z)-3-methylidenepent-1-enyl]-1,3-oxazole?
The InChIKey is HOWBZCFEYSIFEH-SREVYHEPSA-N. The full InChI is InChI=1S/C11H15NO/c1-5-8(2)6-7-11-9(3)13-10(4)12-11/h6-7H,2,5H2,1,3-4H3/b7-6-.
What are the key properties of 2,5-dimethyl-4-[(Z)-3-methylidenepent-1-enyl]-1,3-oxazole?
2,5-dimethyl-4-[(Z)-3-methylidenepent-1-enyl]-1,3-oxazole has a molecular weight of 177.25 g/mol, XLogP of 3.27, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-4-[(Z)-3-methylidenepent-1-enyl]-1,3-oxazole is sourced from PubChem (CID 143346683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).