C31H42N4 — CID 143346727
(Z)-2-[4-[1-[[(6E)-6-butan-2-ylidene-9,9-dimethyl-7-methylidenedec-3-ynyl]amino]ethenyl]-2-methylidene-6-prop-1-en-2-ylpyrimidin-1-yl]but-2-enenitrile (PubChem CID 143346727) has the molecular formula C31H42N4 and a molecular weight of 470.71 g/mol. Its IUPAC name is (Z)-2-[4-[1-[[(6E)-6-butan-2-ylidene-9,9-dimethyl-7-methylidenedec-3-ynyl]amino]ethenyl]-2-methylidene-6-prop-1-en-2-ylpyrimidin-1-yl]but-2-enenitrile.
| Compound Name | (Z)-2-[4-[1-[[(6E)-6-butan-2-ylidene-9,9-dimethyl-7-methylidenedec-3-ynyl]amino]ethenyl]-2-methylidene-6-prop-1-en-2-ylpyrimidin-1-yl]but-2-enenitrile |
|---|---|
| PubChem CID | 143346727 |
| Molecular Formula | C31H42N4 |
| Molecular Weight | 470.71 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | (Z)-2-[4-[1-[[(6E)-6-butan-2-ylidene-9,9-dimethyl-7-methylidenedec-3-ynyl]amino]ethenyl]-2-methylidene-6-prop-1-en-2-ylpyrimidin-1-yl]but-2-enenitrile |
| SMILES | C=C(C)C1=CC(C(=C)NCCC#CC/C(C(=C)CC(C)(C)C)=C(/C)CC)=NC(=C)N1/C(C#N)=C\C |
| InChI | InChI=1S/C31H42N4/c1-12-23(5)28(24(6)20-31(9,10)11)17-15-14-16-18-33-25(7)29-19-30(22(3)4)35(26(8)34-29)27(13-2)21-32/h13,19,33H,3,6-8,12,16-18,20H2,1-2,4-5,9-11H3/b27-13-,28-23+ |
| InChIKey | CTDUBUZPXWQCTE-NVVPROCESA-N |
| XLogP | 7.71 |
| TPSA | 51.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.71 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|