C31H54FN3 — CID 143346739
2-N-[(3Z,5E)-4,5-dimethyl-2-prop-1-enylidenehepta-3,5-dienyl]-7-N,6,6-trimethyl-5-methylidene-3-prop-2-enyliminonon-1-ene-2,7-diamine;ethane;fluoromethane (PubChem CID 143346739) has the molecular formula C31H54FN3 and a molecular weight of 487.79 g/mol. Its IUPAC name is 2-N-[(3Z,5E)-4,5-dimethyl-2-prop-1-enylidenehepta-3,5-dienyl]-7-N,6,6-trimethyl-5-methylidene-3-prop-2-enyliminonon-1-ene-2,7-diamine;ethane;fluoromethane.
| Compound Name | 2-N-[(3Z,5E)-4,5-dimethyl-2-prop-1-enylidenehepta-3,5-dienyl]-7-N,6,6-trimethyl-5-methylidene-3-prop-2-enyliminonon-1-ene-2,7-diamine;ethane;fluoromethane |
|---|---|
| PubChem CID | 143346739 |
| Molecular Formula | C31H54FN3 |
| Molecular Weight | 487.79 g/mol |
| Exact Mass | 487.43 |
| IUPAC Name | 2-N-[(3Z,5E)-4,5-dimethyl-2-prop-1-enylidenehepta-3,5-dienyl]-7-N,6,6-trimethyl-5-methylidene-3-prop-2-enyliminonon-1-ene-2,7-diamine;ethane;fluoromethane |
| SMILES | C=CC/N=C(/CC(=C)C(C)(C)C(CC)NC)C(=C)NCC(=C=CC)/C=C(C)\C(C)=C\C.CC.CF |
| InChI | InChI=1S/C28H45N3.C2H6.CH3F/c1-12-16-25(18-22(6)21(5)14-3)20-31-24(8)26(30-17-13-2)19-23(7)28(9,10)27(15-4)29-11;2*1-2/h12-14,18,27,29,31H,2,7-8,15,17,19-20H2,1,3-6,9-11H3;1-2H3;1H3/b21-14+,22-18-,30-26-;; |
| InChIKey | CGVBWRFIQZYWHP-KRIXEEEQSA-N |
| XLogP | 8.31 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.79 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|