C23H31FN2 — CID 143347280
(2Z,4Z,6E)-6-ethylidene-3-fluoro-2-methyl-N-[(2E)-4-methylidenehexa-2,5-dien-2-yl]-N'-(3-methylidenepenta-1,4-dien-2-yl)hepta-2,4-diene-1,7-diamine (PubChem CID 143347280) has the molecular formula C23H31FN2 and a molecular weight of 354.51 g/mol. Its IUPAC name is (2Z,4Z,6E)-6-ethylidene-3-fluoro-2-methyl-N-[(2E)-4-methylidenehexa-2,5-dien-2-yl]-N'-(3-methylidenepenta-1,4-dien-2-yl)hepta-2,4-diene-1,7-diamine.
| Compound Name | (2Z,4Z,6E)-6-ethylidene-3-fluoro-2-methyl-N-[(2E)-4-methylidenehexa-2,5-dien-2-yl]-N'-(3-methylidenepenta-1,4-dien-2-yl)hepta-2,4-diene-1,7-diamine |
|---|---|
| PubChem CID | 143347280 |
| Molecular Formula | C23H31FN2 |
| Molecular Weight | 354.51 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | (2Z,4Z,6E)-6-ethylidene-3-fluoro-2-methyl-N-[(2E)-4-methylidenehexa-2,5-dien-2-yl]-N'-(3-methylidenepenta-1,4-dien-2-yl)hepta-2,4-diene-1,7-diamine |
| SMILES | C=CC(=C)/C=C(\C)NC/C(C)=C(F)/C=C\C(=C/C)CNC(=C)C(=C)C=C |
| InChI | InChI=1S/C23H31FN2/c1-9-17(4)14-20(7)25-15-19(6)23(24)13-12-22(11-3)16-26-21(8)18(5)10-2/h9-14,25-26H,1-2,4-5,8,15-16H2,3,6-7H3/b13-12-,20-14+,22-11+,23-19- |
| InChIKey | JLTGHYUTYXBOPT-UMZVSMCVSA-N |
| XLogP | 5.81 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.51 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|