C28H38N2O5 — CID 143347332
5-[(E)-5-(2,6-dimethylheptan-2-yloxy)-3-methylpent-2-enyl]-1,3,10-trihydroxy-11H-benzo[b][1,4]benzodiazepin-6-one (PubChem CID 143347332) has the molecular formula C28H38N2O5 and a molecular weight of 482.62 g/mol. Its IUPAC name is 5-[(E)-5-(2,6-dimethylheptan-2-yloxy)-3-methylpent-2-enyl]-1,3,10-trihydroxy-11H-benzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 5-[(E)-5-(2,6-dimethylheptan-2-yloxy)-3-methylpent-2-enyl]-1,3,10-trihydroxy-11H-benzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 143347332 |
| Molecular Formula | C28H38N2O5 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.28 |
| IUPAC Name | 5-[(E)-5-(2,6-dimethylheptan-2-yloxy)-3-methylpent-2-enyl]-1,3,10-trihydroxy-11H-benzo[b][1,4]benzodiazepin-6-one |
| SMILES | C/C(=C\CN1C(=O)c2cccc(O)c2Nc2c(O)cc(O)cc21)CCOC(C)(C)CCCC(C)C |
| InChI | InChI=1S/C28H38N2O5/c1-18(2)8-7-13-28(4,5)35-15-12-19(3)11-14-30-22-16-20(31)17-24(33)26(22)29-25-21(27(30)34)9-6-10-23(25)32/h6,9-11,16-18,29,31-33H,7-8,12-15H2,1-5H3/b19-11+ |
| InChIKey | SBMLHGSWMLNTQX-YBFXNURJSA-N |
| XLogP | 6.47 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|