C12H15NS2 — CID 143347499
N-methanethioyl-5,5,7-trimethylcyclohepta-1,3,6-triene-1-carbothioamide (PubChem CID 143347499) has the molecular formula C12H15NS2 and a molecular weight of 237.39 g/mol. Its IUPAC name is N-methanethioyl-5,5,7-trimethylcyclohepta-1,3,6-triene-1-carbothioamide.
| Compound Name | N-methanethioyl-5,5,7-trimethylcyclohepta-1,3,6-triene-1-carbothioamide |
|---|---|
| PubChem CID | 143347499 |
| Molecular Formula | C12H15NS2 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | N-methanethioyl-5,5,7-trimethylcyclohepta-1,3,6-triene-1-carbothioamide |
| SMILES | CC1=CC(C)(C)C=CC=C1C(=S)NC=S |
| InChI | InChI=1S/C12H15NS2/c1-9-7-12(2,3)6-4-5-10(9)11(15)13-8-14/h4-8H,1-3H3,(H,13,14,15) |
| InChIKey | XQIAGQZHULLTPE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|