C18H33N3O — CID 143347746
ethane;N-[(E)-2-methyl-3-(2-oxo-4-propylpyrrolidin-1-yl)prop-1-enyl]ethanimidoyl cyanide (PubChem CID 143347746) has the molecular formula C18H33N3O and a molecular weight of 307.48 g/mol. Its IUPAC name is ethane;N-[(E)-2-methyl-3-(2-oxo-4-propylpyrrolidin-1-yl)prop-1-enyl]ethanimidoyl cyanide.
| Compound Name | ethane;N-[(E)-2-methyl-3-(2-oxo-4-propylpyrrolidin-1-yl)prop-1-enyl]ethanimidoyl cyanide |
|---|---|
| PubChem CID | 143347746 |
| Molecular Formula | C18H33N3O |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.26 |
| IUPAC Name | ethane;N-[(E)-2-methyl-3-(2-oxo-4-propylpyrrolidin-1-yl)prop-1-enyl]ethanimidoyl cyanide |
| SMILES | CC.CC.CCCC1CC(=O)N(C/C(C)=C/N=C(\C)C#N)C1 |
| InChI | InChI=1S/C14H21N3O.2C2H6/c1-4-5-13-6-14(18)17(10-13)9-11(2)8-16-12(3)7-15;2*1-2/h8,13H,4-6,9-10H2,1-3H3;2*1-2H3/b11-8+,16-12+;; |
| InChIKey | PHPVXXASQCGIBM-IAGVXLIGSA-N |
| XLogP | 4.58 |
| TPSA | 56.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|