C27H44N4S — CID 143348253
[(1Z,6R,13E,18R)-9,18-dimethyl-4,7,10,20-tetramethylidene-6-propan-2-yl-2,5,8,19-tetrazabicyclo[10.5.4]henicosa-1(17),13-dien-3-yl]methanethiol (PubChem CID 143348253) has the molecular formula C27H44N4S and a molecular weight of 456.74 g/mol. Its IUPAC name is [(1Z,6R,13E,18R)-9,18-dimethyl-4,7,10,20-tetramethylidene-6-propan-2-yl-2,5,8,19-tetrazabicyclo[10.5.4]henicosa-1(17),13-dien-3-yl]methanethiol.
| Compound Name | [(1Z,6R,13E,18R)-9,18-dimethyl-4,7,10,20-tetramethylidene-6-propan-2-yl-2,5,8,19-tetrazabicyclo[10.5.4]henicosa-1(17),13-dien-3-yl]methanethiol |
|---|---|
| PubChem CID | 143348253 |
| Molecular Formula | C27H44N4S |
| Molecular Weight | 456.74 g/mol |
| Exact Mass | 456.33 |
| IUPAC Name | [(1Z,6R,13E,18R)-9,18-dimethyl-4,7,10,20-tetramethylidene-6-propan-2-yl-2,5,8,19-tetrazabicyclo[10.5.4]henicosa-1(17),13-dien-3-yl]methanethiol |
| SMILES | C=C1CC2/C=C/CC/C=C(\NC(CS)C(=C)N[C@H](C(C)C)C(=C)NC(C)C(=C)C2)[C@@H](C)N1 |
| InChI | InChI=1S/C27H44N4S/c1-17(2)27-23(8)29-20(5)18(3)14-24-12-10-9-11-13-25(21(6)28-19(4)15-24)31-26(16-32)22(7)30-27/h10,12-13,17,20-21,24,26-32H,3-4,7-9,11,14-16H2,1-2,5-6H3/b12-10+,25-13-/t20?,21-,24?,26?,27-/m1/s1 |
| InChIKey | JQBQUKLTUXXURO-GGQOFWSISA-N |
| XLogP | 5.19 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.74 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|