C30H38N6O2 — CID 143348266
2-[4-[5-cyclohexyl-3-[2-(1-methylcyclohexyl)-2-oxoethyl]-2-oxo-1,3,4-benzotriazepin-1-yl]phenyl]guanidine (PubChem CID 143348266) has the molecular formula C30H38N6O2 and a molecular weight of 514.67 g/mol. Its IUPAC name is 2-[4-[5-cyclohexyl-3-[2-(1-methylcyclohexyl)-2-oxoethyl]-2-oxo-1,3,4-benzotriazepin-1-yl]phenyl]guanidine.
| Compound Name | 2-[4-[5-cyclohexyl-3-[2-(1-methylcyclohexyl)-2-oxoethyl]-2-oxo-1,3,4-benzotriazepin-1-yl]phenyl]guanidine |
|---|---|
| PubChem CID | 143348266 |
| Molecular Formula | C30H38N6O2 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | 2-[4-[5-cyclohexyl-3-[2-(1-methylcyclohexyl)-2-oxoethyl]-2-oxo-1,3,4-benzotriazepin-1-yl]phenyl]guanidine |
| SMILES | CC1(C(=O)CN2N=C(C3CCCCC3)c3ccccc3N(c3ccc(N=C(N)N)cc3)C2=O)CCCCC1 |
| InChI | InChI=1S/C30H38N6O2/c1-30(18-8-3-9-19-30)26(37)20-35-29(38)36(23-16-14-22(15-17-23)33-28(31)32)25-13-7-6-12-24(25)27(34-35)21-10-4-2-5-11-21/h6-7,12-17,21H,2-5,8-11,18-20H2,1H3,(H4,31,32,33) |
| InChIKey | LJKIDYVHKFAWSU-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 117.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|