C13H18FNO — CID 143348564
(2E,4Z)-N-ethyl-6-fluoro-N-methyl-2-prop-2-enylidenehepta-4,6-dienamide (PubChem CID 143348564) has the molecular formula C13H18FNO and a molecular weight of 223.29 g/mol. Its IUPAC name is (2E,4Z)-N-ethyl-6-fluoro-N-methyl-2-prop-2-enylidenehepta-4,6-dienamide.
| Compound Name | (2E,4Z)-N-ethyl-6-fluoro-N-methyl-2-prop-2-enylidenehepta-4,6-dienamide |
|---|---|
| PubChem CID | 143348564 |
| Molecular Formula | C13H18FNO |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | (2E,4Z)-N-ethyl-6-fluoro-N-methyl-2-prop-2-enylidenehepta-4,6-dienamide |
| SMILES | C=C/C=C(\C/C=C\C(=C)F)C(=O)N(C)CC |
| InChI | InChI=1S/C13H18FNO/c1-5-8-12(10-7-9-11(3)14)13(16)15(4)6-2/h5,7-9H,1,3,6,10H2,2,4H3/b9-7-,12-8+ |
| InChIKey | GQXNPUVBFVRGHB-ZUQSVMQASA-N |
| XLogP | 3.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|