About ethane;1-methyl-4-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]imidazolidine
ethane;1-methyl-4-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]imidazolidine (PubChem CID 143348607) has the molecular formula C11H22N2S
and a molecular weight of 214.38 g/mol. Its IUPAC name is ethane;1-methyl-4-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]imidazolidine.
Molecular Properties
| Compound Name | ethane;1-methyl-4-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]imidazolidine |
| PubChem CID | 143348607 |
| Molecular Formula | C11H22N2S |
| Molecular Weight | 214.38 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | ethane;1-methyl-4-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]imidazolidine |
| SMILES | C=C/C=C(\SC)C1CN(C)CN1.CC |
| InChI | InChI=1S/C9H16N2S.C2H6/c1-4-5-9(12-3)8-6-11(2)7-10-8;1-2/h4-5,8,10H,1,6-7H2,2-3H3;1-2H3/b9-5-; |
| InChIKey | BAJDESGZJZZNLR-UYTGOYFPSA-N |
| XLogP | 2.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-methyl-4-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]imidazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-4-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]imidazolidine?
The IUPAC name of ethane;1-methyl-4-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]imidazolidine (CID 143348607) is ethane;1-methyl-4-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]imidazolidine.
What is the SMILES notation for ethane;1-methyl-4-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]imidazolidine?
The canonical SMILES for ethane;1-methyl-4-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]imidazolidine is C=C/C=C(\SC)C1CN(C)CN1.CC.
What is the InChIKey of ethane;1-methyl-4-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]imidazolidine?
The InChIKey is BAJDESGZJZZNLR-UYTGOYFPSA-N. The full InChI is InChI=1S/C9H16N2S.C2H6/c1-4-5-9(12-3)8-6-11(2)7-10-8;1-2/h4-5,8,10H,1,6-7H2,2-3H3;1-2H3/b9-5-;.
What are the key properties of ethane;1-methyl-4-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]imidazolidine?
ethane;1-methyl-4-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]imidazolidine has a molecular weight of 214.38 g/mol, XLogP of 2.31, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-4-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]imidazolidine is sourced from PubChem (CID 143348607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).