C11H22N2S — CID 143348607
ethane;1-methyl-4-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]imidazolidine (PubChem CID 143348607) has the molecular formula C11H22N2S and a molecular weight of 214.38 g/mol. Its IUPAC name is ethane;1-methyl-4-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]imidazolidine.
| Compound Name | ethane;1-methyl-4-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]imidazolidine |
|---|---|
| PubChem CID | 143348607 |
| Molecular Formula | C11H22N2S |
| Molecular Weight | 214.38 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | ethane;1-methyl-4-[(1Z)-1-methylsulfanylbuta-1,3-dienyl]imidazolidine |
| SMILES | C=C/C=C(\SC)C1CN(C)CN1.CC |
| InChI | InChI=1S/C9H16N2S.C2H6/c1-4-5-9(12-3)8-6-11(2)7-10-8;1-2/h4-5,8,10H,1,6-7H2,2-3H3;1-2H3/b9-5-; |
| InChIKey | BAJDESGZJZZNLR-UYTGOYFPSA-N |
| XLogP | 2.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|