C16H29N3 — CID 143348610
ethane;(2Z,4E,6E)-N-methyl-6-(1-methylimidazolidin-4-yl)nona-2,4,6,8-tetraen-4-amine (PubChem CID 143348610) has the molecular formula C16H29N3 and a molecular weight of 263.43 g/mol. Its IUPAC name is ethane;(2Z,4E,6E)-N-methyl-6-(1-methylimidazolidin-4-yl)nona-2,4,6,8-tetraen-4-amine.
| Compound Name | ethane;(2Z,4E,6E)-N-methyl-6-(1-methylimidazolidin-4-yl)nona-2,4,6,8-tetraen-4-amine |
|---|---|
| PubChem CID | 143348610 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | ethane;(2Z,4E,6E)-N-methyl-6-(1-methylimidazolidin-4-yl)nona-2,4,6,8-tetraen-4-amine |
| SMILES | C=C/C=C(\C=C(/C=C\C)NC)C1CN(C)CN1.CC |
| InChI | InChI=1S/C14H23N3.C2H6/c1-5-7-12(9-13(15-3)8-6-2)14-10-17(4)11-16-14;1-2/h5-9,14-16H,1,10-11H2,2-4H3;1-2H3/b8-6-,12-7+,13-9+; |
| InChIKey | RBXJHMZZEGBASU-NSMATUKASA-N |
| XLogP | 2.67 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|