C12H14F6O — CID 143348736
(1E,3E)-1-propan-2-yloxy-5,5-bis(trifluoromethyl)hepta-1,3,6-triene (PubChem CID 143348736) has the molecular formula C12H14F6O and a molecular weight of 288.23 g/mol. Its IUPAC name is (1E,3E)-1-propan-2-yloxy-5,5-bis(trifluoromethyl)hepta-1,3,6-triene.
| Compound Name | (1E,3E)-1-propan-2-yloxy-5,5-bis(trifluoromethyl)hepta-1,3,6-triene |
|---|---|
| PubChem CID | 143348736 |
| Molecular Formula | C12H14F6O |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | (1E,3E)-1-propan-2-yloxy-5,5-bis(trifluoromethyl)hepta-1,3,6-triene |
| SMILES | C=CC(/C=C/C=C/OC(C)C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H14F6O/c1-4-10(11(13,14)15,12(16,17)18)7-5-6-8-19-9(2)3/h4-9H,1H2,2-3H3/b7-5+,8-6+ |
| InChIKey | BDJNTGVJANEVML-KQQUZDAGSA-N |
| XLogP | 4.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|