About 2-methoxy-2,3,7-trimethylbicyclo[3.3.1]nonane
2-methoxy-2,3,7-trimethylbicyclo[3.3.1]nonane (PubChem CID 143348770) has the molecular formula C13H24O
and a molecular weight of 196.33 g/mol. Its IUPAC name is 2-methoxy-2,3,7-trimethylbicyclo[3.3.1]nonane.
Molecular Properties
| Compound Name | 2-methoxy-2,3,7-trimethylbicyclo[3.3.1]nonane |
| PubChem CID | 143348770 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | 2-methoxy-2,3,7-trimethylbicyclo[3.3.1]nonane |
| SMILES | COC1(C)C(C)CC2CC(C)CC1C2 |
| InChI | InChI=1S/C13H24O/c1-9-5-11-7-10(2)13(3,14-4)12(6-9)8-11/h9-12H,5-8H2,1-4H3 |
| InChIKey | BWFGJRRXMNWEEU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methoxy-2,3,7-trimethylbicyclo[3.3.1]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-2,3,7-trimethylbicyclo[3.3.1]nonane?
The IUPAC name of 2-methoxy-2,3,7-trimethylbicyclo[3.3.1]nonane (CID 143348770) is 2-methoxy-2,3,7-trimethylbicyclo[3.3.1]nonane.
What is the SMILES notation for 2-methoxy-2,3,7-trimethylbicyclo[3.3.1]nonane?
The canonical SMILES for 2-methoxy-2,3,7-trimethylbicyclo[3.3.1]nonane is COC1(C)C(C)CC2CC(C)CC1C2.
What is the InChIKey of 2-methoxy-2,3,7-trimethylbicyclo[3.3.1]nonane?
The InChIKey is BWFGJRRXMNWEEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O/c1-9-5-11-7-10(2)13(3,14-4)12(6-9)8-11/h9-12H,5-8H2,1-4H3.
What are the key properties of 2-methoxy-2,3,7-trimethylbicyclo[3.3.1]nonane?
2-methoxy-2,3,7-trimethylbicyclo[3.3.1]nonane has a molecular weight of 196.33 g/mol, XLogP of 3.48, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-2,3,7-trimethylbicyclo[3.3.1]nonane is sourced from PubChem (CID 143348770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).