C24H23N3O5 — CID 143349003
(4Z)-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-5-methyl-2-[3-(morpholine-4-carbonyl)phenyl]pyrazol-3-one (PubChem CID 143349003) has the molecular formula C24H23N3O5 and a molecular weight of 433.46 g/mol. Its IUPAC name is (4Z)-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-5-methyl-2-[3-(morpholine-4-carbonyl)phenyl]pyrazol-3-one.
| Compound Name | (4Z)-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-5-methyl-2-[3-(morpholine-4-carbonyl)phenyl]pyrazol-3-one |
|---|---|
| PubChem CID | 143349003 |
| Molecular Formula | C24H23N3O5 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | (4Z)-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-5-methyl-2-[3-(morpholine-4-carbonyl)phenyl]pyrazol-3-one |
| SMILES | CC1=NN(c2cccc(C(=O)N3CCOCC3)c2)C(=O)/C1=C\c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C24H23N3O5/c1-16-20(13-17-5-6-21-22(14-17)32-12-11-31-21)24(29)27(25-16)19-4-2-3-18(15-19)23(28)26-7-9-30-10-8-26/h2-6,13-15H,7-12H2,1H3/b20-13- |
| InChIKey | YRKGJNDXQBDEFR-MOSHPQCFSA-N |
| XLogP | 2.74 |
| TPSA | 80.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|