C13H25N — CID 143349261
(2E,4Z)-2-ethenyl-N,N-dimethylhexa-2,4-dien-1-amine;propane (PubChem CID 143349261) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is (2E,4Z)-2-ethenyl-N,N-dimethylhexa-2,4-dien-1-amine;propane.
| Compound Name | (2E,4Z)-2-ethenyl-N,N-dimethylhexa-2,4-dien-1-amine;propane |
|---|---|
| PubChem CID | 143349261 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | (2E,4Z)-2-ethenyl-N,N-dimethylhexa-2,4-dien-1-amine;propane |
| SMILES | C=C/C(=C\C=C/C)CN(C)C.CCC |
| InChI | InChI=1S/C10H17N.C3H8/c1-5-7-8-10(6-2)9-11(3)4;1-3-2/h5-8H,2,9H2,1,3-4H3;3H2,1-2H3/b7-5-,10-8+; |
| InChIKey | FJGAXSJZGOVAKK-PJVFXYKKSA-N |
| XLogP | 3.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|