C21H32ClNO2 — CID 143349437
2-amino-2-[2-[2-chloro-4-[(Z,5Z)-5-ethylideneoct-6-enyl]phenyl]ethyl]propane-1,3-diol (PubChem CID 143349437) has the molecular formula C21H32ClNO2 and a molecular weight of 365.95 g/mol. Its IUPAC name is 2-amino-2-[2-[2-chloro-4-[(Z,5Z)-5-ethylideneoct-6-enyl]phenyl]ethyl]propane-1,3-diol.
| Compound Name | 2-amino-2-[2-[2-chloro-4-[(Z,5Z)-5-ethylideneoct-6-enyl]phenyl]ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 143349437 |
| Molecular Formula | C21H32ClNO2 |
| Molecular Weight | 365.95 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 2-amino-2-[2-[2-chloro-4-[(Z,5Z)-5-ethylideneoct-6-enyl]phenyl]ethyl]propane-1,3-diol |
| SMILES | C/C=C\C(=C/C)CCCCc1ccc(CCC(N)(CO)CO)c(Cl)c1 |
| InChI | InChI=1S/C21H32ClNO2/c1-3-7-17(4-2)8-5-6-9-18-10-11-19(20(22)14-18)12-13-21(23,15-24)16-25/h3-4,7,10-11,14,24-25H,5-6,8-9,12-13,15-16,23H2,1-2H3/b7-3-,17-4+ |
| InChIKey | FCAIGEBREQSSMW-QEYKKHLJSA-N |
| XLogP | 4.19 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.95 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|