About (4-methyl-1,3-dioxan-2-ylidene)oxidanium
(4-methyl-1,3-dioxan-2-ylidene)oxidanium (PubChem CID 143349636) has the molecular formula C5H9O3+
and a molecular weight of 117.12 g/mol. Its IUPAC name is (4-methyl-1,3-dioxan-2-ylidene)oxidanium.
Molecular Properties
| Compound Name | (4-methyl-1,3-dioxan-2-ylidene)oxidanium |
| PubChem CID | 143349636 |
| Molecular Formula | C5H9O3+ |
| Molecular Weight | 117.12 g/mol |
| Exact Mass | 117.05 |
| IUPAC Name | (4-methyl-1,3-dioxan-2-ylidene)oxidanium |
| SMILES | [H]/[O+]=C1\OCCC(C)O1 |
| InChI | InChI=1S/C5H8O3/c1-4-2-3-7-5(6)8-4/h4H,2-3H2,1H3/p+1 |
| InChIKey | OVDQEUFSGODEBT-UHFFFAOYSA-O |
| XLogP | 0.27 |
| TPSA | 39.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.12 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze (4-methyl-1,3-dioxan-2-ylidene)oxidanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-1,3-dioxan-2-ylidene)oxidanium?
The IUPAC name of (4-methyl-1,3-dioxan-2-ylidene)oxidanium (CID 143349636) is (4-methyl-1,3-dioxan-2-ylidene)oxidanium.
What is the SMILES notation for (4-methyl-1,3-dioxan-2-ylidene)oxidanium?
The canonical SMILES for (4-methyl-1,3-dioxan-2-ylidene)oxidanium is [H]/[O+]=C1\OCCC(C)O1.
What is the InChIKey of (4-methyl-1,3-dioxan-2-ylidene)oxidanium?
The InChIKey is OVDQEUFSGODEBT-UHFFFAOYSA-O. The full InChI is InChI=1S/C5H8O3/c1-4-2-3-7-5(6)8-4/h4H,2-3H2,1H3/p+1.
What are the key properties of (4-methyl-1,3-dioxan-2-ylidene)oxidanium?
(4-methyl-1,3-dioxan-2-ylidene)oxidanium has a molecular weight of 117.12 g/mol, XLogP of 0.27, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-1,3-dioxan-2-ylidene)oxidanium is sourced from PubChem (CID 143349636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).