C37H51N5O5S — CID 143349763
2-methoxy-2-methylpropane;4-[2-[[3-(1-methylthiopyran-3-yl)-2-[4-(2-morpholin-4-ylethoxy)phenyl]furo[2,3-b]pyridin-4-yl]amino]ethyl]piperazine-1-carbaldehyde (PubChem CID 143349763) has the molecular formula C37H51N5O5S and a molecular weight of 677.91 g/mol. Its IUPAC name is 2-methoxy-2-methylpropane;4-[2-[[3-(1-methylthiopyran-3-yl)-2-[4-(2-morpholin-4-ylethoxy)phenyl]furo[2,3-b]pyridin-4-yl]amino]ethyl]piperazine-1-carbaldehyde.
| Compound Name | 2-methoxy-2-methylpropane;4-[2-[[3-(1-methylthiopyran-3-yl)-2-[4-(2-morpholin-4-ylethoxy)phenyl]furo[2,3-b]pyridin-4-yl]amino]ethyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 143349763 |
| Molecular Formula | C37H51N5O5S |
| Molecular Weight | 677.91 g/mol |
| Exact Mass | 677.36 |
| IUPAC Name | 2-methoxy-2-methylpropane;4-[2-[[3-(1-methylthiopyran-3-yl)-2-[4-(2-morpholin-4-ylethoxy)phenyl]furo[2,3-b]pyridin-4-yl]amino]ethyl]piperazine-1-carbaldehyde |
| SMILES | COC(C)(C)C.CS1=CC=CC(c2c(-c3ccc(OCCN4CCOCC4)cc3)oc3nccc(NCCN4CCN(C=O)CC4)c23)=C1 |
| InChI | InChI=1S/C32H39N5O4S.C5H12O/c1-42-22-2-3-26(23-42)29-30-28(33-10-11-35-12-14-37(24-38)15-13-35)8-9-34-32(30)41-31(29)25-4-6-27(7-5-25)40-21-18-36-16-19-39-20-17-36;1-5(2,3)6-4/h2-9,22-24H,10-21H2,1H3,(H,33,34);1-4H3 |
| InChIKey | KQIWJZOEHZFAFE-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 92.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.91 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|