About (4S)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxan-5-one
(4S)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxan-5-one (PubChem CID 14335026) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is (4S)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxan-5-one.
Molecular Properties
| Compound Name | (4S)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxan-5-one |
| PubChem CID | 14335026 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | (4S)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxan-5-one |
| SMILES | C=CC[C@@H]1OC(C)(C)OCC1=O |
| InChI | InChI=1S/C9H14O3/c1-4-5-8-7(10)6-11-9(2,3)12-8/h4,8H,1,5-6H2,2-3H3/t8-/m0/s1 |
| InChIKey | QZYOYFKZUOVWQY-QMMMGPOBSA-N |
| XLogP | 1.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4S)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxan-5-one?
The IUPAC name of (4S)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxan-5-one (CID 14335026) is (4S)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxan-5-one.
What is the SMILES notation for (4S)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxan-5-one?
The canonical SMILES for (4S)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxan-5-one is C=CC[C@@H]1OC(C)(C)OCC1=O.
What is the InChIKey of (4S)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxan-5-one?
The InChIKey is QZYOYFKZUOVWQY-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H14O3/c1-4-5-8-7(10)6-11-9(2,3)12-8/h4,8H,1,5-6H2,2-3H3/t8-/m0/s1.
What are the key properties of (4S)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxan-5-one?
(4S)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxan-5-one has a molecular weight of 170.21 g/mol, XLogP of 1.28, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxan-5-one is sourced from PubChem (CID 14335026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).