C19H15N3O7S3 — CID 143350433
2-[6-(4-nitrocyclohepta-1,3,6-trien-1-yl)sulfonyloxy-7H-cyclohepta[d][1,3]thiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid (PubChem CID 143350433) has the molecular formula C19H15N3O7S3 and a molecular weight of 493.54 g/mol. Its IUPAC name is 2-[6-(4-nitrocyclohepta-1,3,6-trien-1-yl)sulfonyloxy-7H-cyclohepta[d][1,3]thiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[6-(4-nitrocyclohepta-1,3,6-trien-1-yl)sulfonyloxy-7H-cyclohepta[d][1,3]thiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 143350433 |
| Molecular Formula | C19H15N3O7S3 |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.01 |
| IUPAC Name | 2-[6-(4-nitrocyclohepta-1,3,6-trien-1-yl)sulfonyloxy-7H-cyclohepta[d][1,3]thiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)C1CSC(c2nc3c(s2)=CCC(OS(=O)(=O)C2=CC=C([N+](=O)[O-])CC=C2)=CC=3)=N1 |
| InChI | InChI=1S/C19H15N3O7S3/c23-19(24)15-10-30-17(21-15)18-20-14-8-5-12(6-9-16(14)31-18)29-32(27,28)13-3-1-2-11(4-7-13)22(25)26/h1,3-5,7-9,15H,2,6,10H2,(H,23,24) |
| InChIKey | ICDYWTXZWBCNES-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 149.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|