C18H24O3S — CID 14335176
(3,7,7-trimethyl-2-bicyclo[4.1.0]hept-3-enyl)methyl 4-methylbenzenesulfonate (PubChem CID 14335176) has the molecular formula C18H24O3S and a molecular weight of 320.45 g/mol. Its IUPAC name is (3,7,7-trimethyl-2-bicyclo[4.1.0]hept-3-enyl)methyl 4-methylbenzenesulfonate.
| Compound Name | (3,7,7-trimethyl-2-bicyclo[4.1.0]hept-3-enyl)methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 14335176 |
| Molecular Formula | C18H24O3S |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | (3,7,7-trimethyl-2-bicyclo[4.1.0]hept-3-enyl)methyl 4-methylbenzenesulfonate |
| SMILES | CC1=CCC2C(C1COS(=O)(=O)c1ccc(C)cc1)C2(C)C |
| InChI | InChI=1S/C18H24O3S/c1-12-5-8-14(9-6-12)22(19,20)21-11-15-13(2)7-10-16-17(15)18(16,3)4/h5-9,15-17H,10-11H2,1-4H3 |
| InChIKey | FCXJPNDNSNTRKE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|