C35H54N6O7 — CID 143352000
[2-[[2-[(3R)-2-[(1-amino-1,2-dioxohexan-3-yl)carbamoyl]-3-propan-2-ylpyrrolidin-1-yl]-1-(2,3-dihydro-1H-inden-2-yl)-2-oxoethyl]carbamoylamino]-3,3-dimethylbutyl] N-ethylcarbamate (PubChem CID 143352000) has the molecular formula C35H54N6O7 and a molecular weight of 670.85 g/mol. Its IUPAC name is [2-[[2-[(3R)-2-[(1-amino-1,2-dioxohexan-3-yl)carbamoyl]-3-propan-2-ylpyrrolidin-1-yl]-1-(2,3-dihydro-1H-inden-2-yl)-2-oxoethyl]carbamoylamino]-3,3-dimethylbutyl] N-ethylcarbamate.
| Compound Name | [2-[[2-[(3R)-2-[(1-amino-1,2-dioxohexan-3-yl)carbamoyl]-3-propan-2-ylpyrrolidin-1-yl]-1-(2,3-dihydro-1H-inden-2-yl)-2-oxoethyl]carbamoylamino]-3,3-dimethylbutyl] N-ethylcarbamate |
|---|---|
| PubChem CID | 143352000 |
| Molecular Formula | C35H54N6O7 |
| Molecular Weight | 670.85 g/mol |
| Exact Mass | 670.41 |
| IUPAC Name | [2-[[2-[(3R)-2-[(1-amino-1,2-dioxohexan-3-yl)carbamoyl]-3-propan-2-ylpyrrolidin-1-yl]-1-(2,3-dihydro-1H-inden-2-yl)-2-oxoethyl]carbamoylamino]-3,3-dimethylbutyl] N-ethylcarbamate |
| SMILES | CCCC(NC(=O)C1[C@@H](C(C)C)CCN1C(=O)C(NC(=O)NC(COC(=O)NCC)C(C)(C)C)C1Cc2ccccc2C1)C(=O)C(N)=O |
| InChI | InChI=1S/C35H54N6O7/c1-8-12-25(29(42)30(36)43)38-31(44)28-24(20(3)4)15-16-41(28)32(45)27(23-17-21-13-10-11-14-22(21)18-23)40-33(46)39-26(35(5,6)7)19-48-34(47)37-9-2/h10-11,13-14,20,23-28H,8-9,12,15-19H2,1-7H3,(H2,36,43)(H,37,47)(H,38,44)(H2,39,40,46)/t24-,25?,26?,27?,28?/m1/s1 |
| InChIKey | ZAXLNXIMWZEDBK-KTTODTSBSA-N |
| XLogP | 2.44 |
| TPSA | 189.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.85 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|