C26H34O15 — CID 14335207
methyl (4S,5E,6S)-5-ethylidene-4-(2-methoxy-2-oxoethyl)-6-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-4H-pyran-3-carboxylate (PubChem CID 14335207) has the molecular formula C26H34O15 and a molecular weight of 586.54 g/mol. Its IUPAC name is methyl (4S,5E,6S)-5-ethylidene-4-(2-methoxy-2-oxoethyl)-6-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-4H-pyran-3-carboxylate.
| Compound Name | methyl (4S,5E,6S)-5-ethylidene-4-(2-methoxy-2-oxoethyl)-6-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 14335207 |
| Molecular Formula | C26H34O15 |
| Molecular Weight | 586.54 g/mol |
| Exact Mass | 586.19 |
| IUPAC Name | methyl (4S,5E,6S)-5-ethylidene-4-(2-methoxy-2-oxoethyl)-6-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-4H-pyran-3-carboxylate |
| SMILES | C/C=C1/[C@H](O[C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)OC=C(C(=O)OC)[C@H]1CC(=O)OC |
| InChI | InChI=1S/C26H34O15/c1-8-16-17(9-20(31)33-6)18(24(32)34-7)10-36-25(16)41-26-23(39-15(5)30)22(38-14(4)29)21(37-13(3)28)19(40-26)11-35-12(2)27/h8,10,17,19,21-23,25-26H,9,11H2,1-7H3/b16-8+/t17-,19+,21+,22-,23+,25-,26-/m0/s1 |
| InChIKey | GLGKJNCYCRLZNC-FMPFNHSXSA-N |
| XLogP | 0.62 |
| TPSA | 185.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.54 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|