C9H13NO2 — CID 143352287
7a-methyl-1,2,3,3a-tetrahydroisoindole-1,3-diol (PubChem CID 143352287) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 7a-methyl-1,2,3,3a-tetrahydroisoindole-1,3-diol.
| Compound Name | 7a-methyl-1,2,3,3a-tetrahydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 143352287 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 7a-methyl-1,2,3,3a-tetrahydroisoindole-1,3-diol |
| SMILES | CC12C=CC=CC1C(O)NC2O |
| InChI | InChI=1S/C9H13NO2/c1-9-5-3-2-4-6(9)7(11)10-8(9)12/h2-8,10-12H,1H3 |
| InChIKey | BFCATXQQDIZBFK-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |