C27H49N5O5 — CID 143353104
1-[3,3-dimethyl-2-(methylcarbamoylamino)butanoyl]-N-(1,2-dioxohept-6-en-3-yl)pyrrolidine-2-carboxamide;N-methylprop-2-en-1-amine;propane (PubChem CID 143353104) has the molecular formula C27H49N5O5 and a molecular weight of 523.72 g/mol. Its IUPAC name is 1-[3,3-dimethyl-2-(methylcarbamoylamino)butanoyl]-N-(1,2-dioxohept-6-en-3-yl)pyrrolidine-2-carboxamide;N-methylprop-2-en-1-amine;propane.
| Compound Name | 1-[3,3-dimethyl-2-(methylcarbamoylamino)butanoyl]-N-(1,2-dioxohept-6-en-3-yl)pyrrolidine-2-carboxamide;N-methylprop-2-en-1-amine;propane |
|---|---|
| PubChem CID | 143353104 |
| Molecular Formula | C27H49N5O5 |
| Molecular Weight | 523.72 g/mol |
| Exact Mass | 523.37 |
| IUPAC Name | 1-[3,3-dimethyl-2-(methylcarbamoylamino)butanoyl]-N-(1,2-dioxohept-6-en-3-yl)pyrrolidine-2-carboxamide;N-methylprop-2-en-1-amine;propane |
| SMILES | C=CCCC(NC(=O)C1CCCN1C(=O)C(NC(=O)NC)C(C)(C)C)C(=O)C=O.C=CCNC.CCC |
| InChI | InChI=1S/C20H32N4O5.C4H9N.C3H8/c1-6-7-9-13(15(26)12-25)22-17(27)14-10-8-11-24(14)18(28)16(20(2,3)4)23-19(29)21-5;1-3-4-5-2;1-3-2/h6,12-14,16H,1,7-11H2,2-5H3,(H,22,27)(H2,21,23,29);3,5H,1,4H2,2H3;3H2,1-2H3 |
| InChIKey | CEALBBGMIVDMDQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.72 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|