C29H46F3N5O6S — CID 143353157
(2S)-1-[2-[(1-cyclopropyl-3-methyl-1-oxobutan-2-yl)carbamoylamino]-3,3-dimethylbutanoyl]-N-[3,4-dioxo-4-(propylamino)-1-(2,2,2-trifluoroethylsulfanyl)butan-2-yl]pyrrolidine-2-carboxamide (PubChem CID 143353157) has the molecular formula C29H46F3N5O6S and a molecular weight of 649.78 g/mol. Its IUPAC name is (2S)-1-[2-[(1-cyclopropyl-3-methyl-1-oxobutan-2-yl)carbamoylamino]-3,3-dimethylbutanoyl]-N-[3,4-dioxo-4-(propylamino)-1-(2,2,2-trifluoroethylsulfanyl)butan-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[2-[(1-cyclopropyl-3-methyl-1-oxobutan-2-yl)carbamoylamino]-3,3-dimethylbutanoyl]-N-[3,4-dioxo-4-(propylamino)-1-(2,2,2-trifluoroethylsulfanyl)butan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143353157 |
| Molecular Formula | C29H46F3N5O6S |
| Molecular Weight | 649.78 g/mol |
| Exact Mass | 649.31 |
| IUPAC Name | (2S)-1-[2-[(1-cyclopropyl-3-methyl-1-oxobutan-2-yl)carbamoylamino]-3,3-dimethylbutanoyl]-N-[3,4-dioxo-4-(propylamino)-1-(2,2,2-trifluoroethylsulfanyl)butan-2-yl]pyrrolidine-2-carboxamide |
| SMILES | CCCNC(=O)C(=O)C(CSCC(F)(F)F)NC(=O)[C@@H]1CCCN1C(=O)C(NC(=O)NC(C(=O)C1CC1)C(C)C)C(C)(C)C |
| InChI | InChI=1S/C29H46F3N5O6S/c1-7-12-33-25(41)22(39)18(14-44-15-29(30,31)32)34-24(40)19-9-8-13-37(19)26(42)23(28(4,5)6)36-27(43)35-20(16(2)3)21(38)17-10-11-17/h16-20,23H,7-15H2,1-6H3,(H,33,41)(H,34,40)(H2,35,36,43)/t18?,19-,20?,23?/m0/s1 |
| InChIKey | LZOOFRQOSKJNGD-GNERAIRZSA-N |
| XLogP | 2.57 |
| TPSA | 153.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.78 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|