C25H41NO4 — CID 143354007
2-methylpropyl (E,5S)-6-[(2S)-2-acetyl-4,4-dimethylpyrrolidin-1-yl]-5-(1-methylcyclohexyl)-6-oxohex-3-enoate (PubChem CID 143354007) has the molecular formula C25H41NO4 and a molecular weight of 419.61 g/mol. Its IUPAC name is 2-methylpropyl (E,5S)-6-[(2S)-2-acetyl-4,4-dimethylpyrrolidin-1-yl]-5-(1-methylcyclohexyl)-6-oxohex-3-enoate.
| Compound Name | 2-methylpropyl (E,5S)-6-[(2S)-2-acetyl-4,4-dimethylpyrrolidin-1-yl]-5-(1-methylcyclohexyl)-6-oxohex-3-enoate |
|---|---|
| PubChem CID | 143354007 |
| Molecular Formula | C25H41NO4 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.30 |
| IUPAC Name | 2-methylpropyl (E,5S)-6-[(2S)-2-acetyl-4,4-dimethylpyrrolidin-1-yl]-5-(1-methylcyclohexyl)-6-oxohex-3-enoate |
| SMILES | CC(=O)[C@@H]1CC(C)(C)CN1C(=O)[C@@H](/C=C/CC(=O)OCC(C)C)C1(C)CCCCC1 |
| InChI | InChI=1S/C25H41NO4/c1-18(2)16-30-22(28)12-10-11-20(25(6)13-8-7-9-14-25)23(29)26-17-24(4,5)15-21(26)19(3)27/h10-11,18,20-21H,7-9,12-17H2,1-6H3/b11-10+/t20-,21+/m1/s1 |
| InChIKey | DWYBCAOBOWWFJR-HZYCFNBMSA-N |
| XLogP | 4.93 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|