About 1-[(1S,5R)-3,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]ethanone
1-[(1S,5R)-3,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]ethanone (PubChem CID 143354040) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is 1-[(1S,5R)-3,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]ethanone.
Molecular Properties
| Compound Name | 1-[(1S,5R)-3,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]ethanone |
| PubChem CID | 143354040 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 1-[(1S,5R)-3,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]ethanone |
| SMILES | CC(=O)C1[C@H]2C(C)[C@H]2CN1C |
| InChI | InChI=1S/C9H15NO/c1-5-7-4-10(3)9(6(2)11)8(5)7/h5,7-9H,4H2,1-3H3/t5?,7-,8+,9?/m1/s1 |
| InChIKey | AJVVZNVQJDIKJH-BYKGVSGHSA-N |
| XLogP | 0.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(1S,5R)-3,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,5R)-3,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]ethanone?
The IUPAC name of 1-[(1S,5R)-3,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]ethanone (CID 143354040) is 1-[(1S,5R)-3,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]ethanone.
What is the SMILES notation for 1-[(1S,5R)-3,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]ethanone?
The canonical SMILES for 1-[(1S,5R)-3,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]ethanone is CC(=O)C1[C@H]2C(C)[C@H]2CN1C.
What is the InChIKey of 1-[(1S,5R)-3,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]ethanone?
The InChIKey is AJVVZNVQJDIKJH-BYKGVSGHSA-N. The full InChI is InChI=1S/C9H15NO/c1-5-7-4-10(3)9(6(2)11)8(5)7/h5,7-9H,4H2,1-3H3/t5?,7-,8+,9?/m1/s1.
What are the key properties of 1-[(1S,5R)-3,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]ethanone?
1-[(1S,5R)-3,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]ethanone has a molecular weight of 153.22 g/mol, XLogP of 0.77, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,5R)-3,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]ethanone is sourced from PubChem (CID 143354040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).