About ethane;N-ethyl-N-methylbut-3-en-1-amine;(Z)-pent-3-enal
ethane;N-ethyl-N-methylbut-3-en-1-amine;(Z)-pent-3-enal (PubChem CID 143355160) has the molecular formula C14H29NO
and a molecular weight of 227.39 g/mol. Its IUPAC name is ethane;N-ethyl-N-methylbut-3-en-1-amine;(Z)-pent-3-enal.
Molecular Properties
| Compound Name | ethane;N-ethyl-N-methylbut-3-en-1-amine;(Z)-pent-3-enal |
| PubChem CID | 143355160 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | ethane;N-ethyl-N-methylbut-3-en-1-amine;(Z)-pent-3-enal |
| SMILES | C/C=C\CC=O.C=CCCN(C)CC.CC |
| InChI | InChI=1S/C7H15N.C5H8O.C2H6/c1-4-6-7-8(3)5-2;1-2-3-4-5-6;1-2/h4H,1,5-7H2,2-3H3;2-3,5H,4H2,1H3;1-2H3/b;3-2-; |
| InChIKey | YQPVKPZNSOONQP-PMOSZIESSA-N |
| XLogP | 3.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-ethyl-N-methylbut-3-en-1-amine;(Z)-pent-3-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-ethyl-N-methylbut-3-en-1-amine;(Z)-pent-3-enal?
The IUPAC name of ethane;N-ethyl-N-methylbut-3-en-1-amine;(Z)-pent-3-enal (CID 143355160) is ethane;N-ethyl-N-methylbut-3-en-1-amine;(Z)-pent-3-enal.
What is the SMILES notation for ethane;N-ethyl-N-methylbut-3-en-1-amine;(Z)-pent-3-enal?
The canonical SMILES for ethane;N-ethyl-N-methylbut-3-en-1-amine;(Z)-pent-3-enal is C/C=C\CC=O.C=CCCN(C)CC.CC.
What is the InChIKey of ethane;N-ethyl-N-methylbut-3-en-1-amine;(Z)-pent-3-enal?
The InChIKey is YQPVKPZNSOONQP-PMOSZIESSA-N. The full InChI is InChI=1S/C7H15N.C5H8O.C2H6/c1-4-6-7-8(3)5-2;1-2-3-4-5-6;1-2/h4H,1,5-7H2,2-3H3;2-3,5H,4H2,1H3;1-2H3/b;3-2-;.
What are the key properties of ethane;N-ethyl-N-methylbut-3-en-1-amine;(Z)-pent-3-enal?
ethane;N-ethyl-N-methylbut-3-en-1-amine;(Z)-pent-3-enal has a molecular weight of 227.39 g/mol, XLogP of 3.69, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-ethyl-N-methylbut-3-en-1-amine;(Z)-pent-3-enal is sourced from PubChem (CID 143355160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).